* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product_Name: | WUXIAPPTEC WX105374-001 |
| EnglishSynonyms: | WUXIAPPTEC WX105374-005 ; WUXIAPPTEC WX105374-001 ; WUXIAPPTEC WX105374-010 |
| pro_mdlNumber: | MFCD17017251 |
| pro_acceptors: | 10 |
| pro_donors: | 1 |
| pro_smile: | CC(C)(C)OC(=O)N1C[C@@]2(CC(=NO2)C(O)=O)[C@@H]2CN(C[C@H]12)C(=O)OCC1=CC=CC=C1 |
| InChi: | InChI=1S/C22H27N3O7/c1-21(2,3)31-20(29)25-13-22(9-16(18(26)27)23-32-22)15-10-24(11-17(15)25)19(28)30-12-14-7-5-4-6-8-14/h4-8,15,17H,9-13H2,1-3H3,(H,26,27)/t15-,17+,22+/m1/s1 |
| InChiKey: | InChIKey=HTIRHAWPLCMWQJ-ZWWNWMABSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.