* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product_Name: | WUXIAPPTEC WX115209-001 |
| EnglishSynonyms: | WUXIAPPTEC WX115209-001 ; WUXIAPPTEC WX115209-005 ; WUXIAPPTEC WX115209-010 |
| pro_mdlNumber: | MFCD17017257 |
| pro_acceptors: | 8 |
| pro_donors: | 1 |
| pro_smile: | CC(C)(C)OC(=O)N1C[C@@H]2[C@H](C1)C1=C(C=NN1)N2C(=O)OCC1=CC=CC=C1 |
| InChi: | InChI=1S/C20H24N4O4/c1-20(2,3)28-18(25)23-10-14-16(11-23)24(15-9-21-22-17(14)15)19(26)27-12-13-7-5-4-6-8-13/h4-9,14,16H,10-12H2,1-3H3,(H,21,22)/t14-,16+/m0/s1 |
| InChiKey: | InChIKey=MBYMRDYERNLVIF-GOEBONIOSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.