* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product_Name: | WUXIAPPTEC WX105375-001 |
| EnglishSynonyms: | WUXIAPPTEC WX105375-005 ; WUXIAPPTEC WX105375-001 ; WUXIAPPTEC WX105375-010 |
| pro_mdlNumber: | MFCD17017262 |
| pro_acceptors: | 10 |
| pro_donors: | 1 |
| pro_smile: | CC(C)(C)OC(=O)N1CC[C@@H]2C(C1)[C@@]1(CN2C(=O)OCC2=CC=CC=C2)CC(=NO1)C(O)=O |
| InChi: | InChI=1S/C23H29N3O7/c1-22(2,3)32-20(29)25-10-9-18-16(12-25)23(11-17(19(27)28)24-33-23)14-26(18)21(30)31-13-15-7-5-4-6-8-15/h4-8,16,18H,9-14H2,1-3H3,(H,27,28)/t16?,18-,23+/m1/s1 |
| InChiKey: | InChIKey=NIBNQCVDXIZWLQ-TUUUUVLKSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.