* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product_Name: | WUXIAPPTEC WX145109-001 |
| EnglishSynonyms: | WUXIAPPTEC WX145109-010 ; WUXIAPPTEC WX145109-005 ; WUXIAPPTEC WX145109-001 |
| pro_mdlNumber: | MFCD17017294 |
| pro_acceptors: | 4 |
| pro_donors: | 2 |
| pro_smile: | NC1CC(CC2=C1N=NN2)C1=CC=CC=C1 |
| InChi: | InChI=1S/C12H14N4/c13-10-6-9(8-4-2-1-3-5-8)7-11-12(10)15-16-14-11/h1-5,9-10H,6-7,13H2,(H,14,15,16) |
| InChiKey: | InChIKey=SBHDOCCZMJFUAV-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.