* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product_Name: | WUXIAPPTEC WX130051-001 |
| EnglishSynonyms: | WUXIAPPTEC WX130051-001 ; WUXIAPPTEC WX130051-005 ; WUXIAPPTEC WX130051-010 |
| pro_mdlNumber: | MFCD17017303 |
| pro_acceptors: | 8 |
| pro_donors: | 3 |
| pro_smile: | CC(C)(C)OC(=O)NCC1=NC2=C(NC(=C2)C(O)=O)O1 |
| InChi: | InChI=1S/C12H15N3O5/c1-12(2,3)20-11(18)13-5-8-14-6-4-7(10(16)17)15-9(6)19-8/h4,15H,5H2,1-3H3,(H,13,18)(H,16,17) |
| InChiKey: | InChIKey=COLWMTCJSKAROY-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.