* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product_Name: | WUXIAPPTEC WX120175-001 |
| EnglishSynonyms: | WUXIAPPTEC WX120175-010 ; WUXIAPPTEC WX120175-001 ; WUXIAPPTEC WX120175-005 |
| pro_mdlNumber: | MFCD17017304 |
| pro_acceptors: | 5 |
| pro_donors: | 1 |
| pro_smile: | CC(C)(C)OC(=O)N1CC2CC1[C@@H](CN)O2 |
| InChi: | InChI=1S/C11H20N2O3/c1-11(2,3)16-10(14)13-6-7-4-8(13)9(5-12)15-7/h7-9H,4-6,12H2,1-3H3/t7?,8?,9-/m1/s1 |
| InChiKey: | InChIKey=NXMDBJHJGDPOJA-AMDVSUOASA-N |
* If the product has intellectual property rights, a license granted is must or contact us.