* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product_Name: | WUXIAPPTEC WX125087-001 |
| EnglishSynonyms: | WUXIAPPTEC WX125087-010 ; WUXIAPPTEC WX125087-001 ; WUXIAPPTEC WX125087-005 |
| pro_mdlNumber: | MFCD17017305 |
| pro_acceptors: | 6 |
| pro_donors: | 0 |
| pro_smile: | CCOC(=O)CC1(OC2CC1N(C2)C(=O)OC(C)(C)C)C1=CC=CC=C1 |
| InChi: | InChI=1S/C20H27NO5/c1-5-24-17(22)12-20(14-9-7-6-8-10-14)16-11-15(25-20)13-21(16)18(23)26-19(2,3)4/h6-10,15-16H,5,11-13H2,1-4H3 |
| InChiKey: | InChIKey=UMVOFGTYFRERMW-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.