* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product_Name: | WUXIAPPTEC WX140145-001 |
| EnglishSynonyms: | WUXIAPPTEC WX140145-010 ; WUXIAPPTEC WX140145-005 ; WUXIAPPTEC WX140145-001 |
| pro_mdlNumber: | MFCD17017327 |
| pro_acceptors: | 6 |
| pro_donors: | 2 |
| pro_smile: | NC1=CN=C2COC(CN12)C(O)=O |
| InChi: | InChI=1S/C7H9N3O3/c8-5-1-9-6-3-13-4(7(11)12)2-10(5)6/h1,4H,2-3,8H2,(H,11,12) |
| InChiKey: | InChIKey=PISFRNUNGMCOJS-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.