* If the product has intellectual property rights, a license granted is must or contact us.
basic_info |
|
Product_Name: | WUXIAPPTEC WX105383-001 |
EnglishSynonyms: | WUXIAPPTEC WX105383-001 ; WUXIAPPTEC WX105383-010 ; WUXIAPPTEC WX105383-005 |
pro_mdlNumber: | MFCD17017343 |
pro_acceptors: | 7 |
pro_donors: | 0 |
pro_smile: | CCOC(=O)C1=C2N(C=N1)C1=CC=CC=C1C21CN(C1)C(=O)OC(C)(C)C |
InChi: | InChI=1S/C20H23N3O4/c1-5-26-17(24)15-16-20(10-22(11-20)18(25)27-19(2,3)4)13-8-6-7-9-14(13)23(16)12-21-15/h6-9,12H,5,10-11H2,1-4H3 |
InChiKey: | InChIKey=FFTXTVVKLRPDJR-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.