* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product_Name: | WUXIAPPTEC WX105397-001 |
| EnglishSynonyms: | WUXIAPPTEC WX105397-005 ; WUXIAPPTEC WX105397-001 ; WUXIAPPTEC WX105397-010 |
| pro_mdlNumber: | MFCD17017363 |
| pro_acceptors: | 6 |
| pro_donors: | 1 |
| pro_smile: | CC(C)(C)OC(=O)N1CCC2(CC1)CNC1=NC=CN1C2 |
| InChi: | InChI=1S/C15H24N4O2/c1-14(2,3)21-13(20)18-7-4-15(5-8-18)10-17-12-16-6-9-19(12)11-15/h6,9H,4-5,7-8,10-11H2,1-3H3,(H,16,17) |
| InChiKey: | InChIKey=SPWCOEUFRKZOGL-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.