* If the product has intellectual property rights, a license granted is must or contact us.
|
|
Product_Name: | WUXIAPPTEC WX125111-001 |
EnglishSynonyms: | WUXIAPPTEC WX125111-001 ; WUXIAPPTEC WX125111-005 ; WUXIAPPTEC WX125111-010 |
pro_mdlNumber: | MFCD17017368 |
pro_acceptors: | 6 |
pro_donors: | 1 |
pro_smile: | CC(C)(C)OC(=O)N1CCC23CNCC(CC(=O)C12)O3 |
InChi: | InChI=1S/C14H22N2O4/c1-13(2,3)20-12(18)16-5-4-14-8-15-7-9(19-14)6-10(17)11(14)16/h9,11,15H,4-8H2,1-3H3 |
InChiKey: | InChIKey=XMZZEGSTWANGSX-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.