* If the product has intellectual property rights, a license granted is must or contact us.
basic_info |
|
Product_Name: | WUXIAPPTEC WX105412-001 |
EnglishSynonyms: | WUXIAPPTEC WX105412-010 ; WUXIAPPTEC WX105412-001 ; WUXIAPPTEC WX105412-005 |
pro_mdlNumber: | MFCD17017417 |
pro_acceptors: | 5 |
pro_donors: | 3 |
pro_smile: | O=C1NCCC[C@@]11CNC[C@@H]1C1=CNC=N1 |
InChi: | InChI=1S/C11H16N4O/c16-10-11(2-1-3-14-10)6-12-4-8(11)9-5-13-7-15-9/h5,7-8,12H,1-4,6H2,(H,13,15)(H,14,16)/t8-,11+/m1/s1 |
InChiKey: | InChIKey=KOBIVOFIDRDUBE-KCJUWKMLSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.