* If the product has intellectual property rights, a license granted is must or contact us.
basic_info |
|
Product_Name: | WUXIAPPTEC WX115269-001 |
EnglishSynonyms: | WUXIAPPTEC WX115269-010 ; WUXIAPPTEC WX115269-005 ; WUXIAPPTEC WX115269-001 |
pro_mdlNumber: | MFCD17017467 |
pro_acceptors: | 5 |
pro_donors: | 0 |
pro_smile: | [H][C@]12C[C@@H]3ON=C(Br)[C@@H]3[C@@]1([H])OC(C2)C(=O)OCC |
InChi: | InChI=1S/C11H14BrNO4/c1-2-15-11(14)7-4-5-3-6-8(9(5)16-7)10(12)13-17-6/h5-9H,2-4H2,1H3/t5-,6+,7?,8+,9+/m1/s1 |
InChiKey: | InChIKey=LQBJUAPWHQDUBF-VTBPIOEASA-N |
* If the product has intellectual property rights, a license granted is must or contact us.