* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product_Name: | WUXIAPPTEC WX115282-001 |
| EnglishSynonyms: | WUXIAPPTEC WX115282-005 ; WUXIAPPTEC WX115282-010 ; WUXIAPPTEC WX115282-001 |
| pro_mdlNumber: | MFCD17017483 |
| pro_acceptors: | 9 |
| pro_donors: | 1 |
| pro_smile: | CC(C)(C)OC(=O)N1CCC(CC1)C12COC(C1CN(C2)C(=O)OCC1=CC=CC=C1)C(O)=O |
| InChi: | InChI=1S/C25H34N2O7/c1-24(2,3)34-23(31)26-11-9-18(10-12-26)25-15-27(13-19(25)20(21(28)29)33-16-25)22(30)32-14-17-7-5-4-6-8-17/h4-8,18-20H,9-16H2,1-3H3,(H,28,29) |
| InChiKey: | InChIKey=LIODFQPZBSKQPW-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.