* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product_Name: | WUXIAPPTEC WX115285-001 |
| EnglishSynonyms: | WUXIAPPTEC WX115285-005 ; WUXIAPPTEC WX115285-001 ; WUXIAPPTEC WX115285-010 |
| pro_mdlNumber: | MFCD17017486 |
| pro_acceptors: | 7 |
| pro_donors: | 2 |
| pro_smile: | OC(=O)C1=CC=C(N1)C12COCC1CN(C2)C(=O)OCC1=CC=CC=C1 |
| InChi: | InChI=1S/C19H20N2O5/c22-17(23)15-6-7-16(20-15)19-11-21(8-14(19)10-25-12-19)18(24)26-9-13-4-2-1-3-5-13/h1-7,14,20H,8-12H2,(H,22,23) |
| InChiKey: | InChIKey=PVUPCBUTQKMRGZ-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.