* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product_Name: | WUXIAPPTEC WX140166-001 |
| EnglishSynonyms: | WUXIAPPTEC WX140166-005 ; WUXIAPPTEC WX140166-001 ; WUXIAPPTEC WX140166-010 |
| pro_mdlNumber: | MFCD17017511 |
| pro_acceptors: | 7 |
| pro_donors: | 1 |
| pro_smile: | CCOC(=O)CC1N(CC2=C1C(O)=CN=C2)C(=O)OC(C)(C)C |
| InChi: | InChI=1S/C16H22N2O5/c1-5-22-13(20)6-11-14-10(7-17-8-12(14)19)9-18(11)15(21)23-16(2,3)4/h7-8,11,19H,5-6,9H2,1-4H3 |
| InChiKey: | InChIKey=PQGLNDVDJTVSSP-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.