* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product_Name: | WUXIAPPTEC WX115224-001 |
| EnglishSynonyms: | WUXIAPPTEC WX115224-010 ; WUXIAPPTEC WX115224-001 ; WUXIAPPTEC WX115224-005 |
| pro_mdlNumber: | MFCD17017549 |
| pro_acceptors: | 6 |
| pro_donors: | 2 |
| pro_smile: | CC(C)(C)OC(=O)N1CC[C@]23CNC[C@H]2C(=O)N[C@@H]3C1 |
| InChi: | InChI=1S/C14H23N3O3/c1-13(2,3)20-12(19)17-5-4-14-8-15-6-9(14)11(18)16-10(14)7-17/h9-10,15H,4-8H2,1-3H3,(H,16,18)/t9-,10+,14-/m0/s1 |
| InChiKey: | InChIKey=QSOKWZWIGWJXCR-RBZYPMLTSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.