* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product_Name: | WUXIAPPTEC WX115287-001 |
| EnglishSynonyms: | WUXIAPPTEC WX115287-005 ; WUXIAPPTEC WX115287-001 ; WUXIAPPTEC WX115287-010 |
| pro_mdlNumber: | MFCD17017559 |
| pro_acceptors: | 6 |
| pro_donors: | 2 |
| pro_smile: | CC(C)(C)OC(=O)N1CC2C(=O)NC3CCNC23C1 |
| InChi: | InChI=1S/C13H21N3O3/c1-12(2,3)19-11(18)16-6-8-10(17)15-9-4-5-14-13(8,9)7-16/h8-9,14H,4-7H2,1-3H3,(H,15,17) |
| InChiKey: | InChIKey=IJSZJMWAVLNNQP-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.