* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product_Name: | WUXIAPPTEC WX115307-001 |
| EnglishSynonyms: | WUXIAPPTEC WX115307-010 ; WUXIAPPTEC WX115307-001 ; WUXIAPPTEC WX115307-005 |
| pro_mdlNumber: | MFCD17017566 |
| pro_acceptors: | 6 |
| pro_donors: | 1 |
| pro_smile: | CC(C)(C)OC(=O)N1CC2C(=O)NCC3CCOCC23C1 |
| InChi: | InChI=1S/C15H24N2O4/c1-14(2,3)21-13(19)17-7-11-12(18)16-6-10-4-5-20-9-15(10,11)8-17/h10-11H,4-9H2,1-3H3,(H,16,18) |
| InChiKey: | InChIKey=MXUGMCYSTQAOLY-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.