* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product_Name: | WUXIAPPTEC WX115306-001 |
| EnglishSynonyms: | WUXIAPPTEC WX115306-010 ; WUXIAPPTEC WX115306-001 ; WUXIAPPTEC WX115306-005 |
| pro_mdlNumber: | MFCD17017569 |
| pro_acceptors: | 6 |
| pro_donors: | 1 |
| pro_smile: | CC(C)(C)OC(=O)N1CC2C(=O)NCC3OCCC23C1 |
| InChi: | InChI=1S/C14H22N2O4/c1-13(2,3)20-12(18)16-7-9-11(17)15-6-10-14(9,8-16)4-5-19-10/h9-10H,4-8H2,1-3H3,(H,15,17) |
| InChiKey: | InChIKey=ZTPNJGFFCXGYBF-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.