* If the product has intellectual property rights, a license granted is must or contact us.
|
|
Product_Name: | WUXIAPPTEC WX115309-001 |
EnglishSynonyms: | WUXIAPPTEC WX115309-005 ; WUXIAPPTEC WX115309-010 ; WUXIAPPTEC WX115309-001 |
pro_mdlNumber: | MFCD17017570 |
pro_acceptors: | 6 |
pro_donors: | 1 |
pro_smile: | CC(C)(C)OC(=O)N1CC2C(=O)NCC3OCCCC23C1 |
InChi: | InChI=1S/C15H24N2O4/c1-14(2,3)21-13(19)17-8-10-12(18)16-7-11-15(10,9-17)5-4-6-20-11/h10-11H,4-9H2,1-3H3,(H,16,18) |
InChiKey: | InChIKey=DEADIWDHEBQJAT-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.