* If the product has intellectual property rights, a license granted is must or contact us.
|
|
Product_Name: | WUXIAPPTEC WX115317-001 |
EnglishSynonyms: | WUXIAPPTEC WX115317-005 ; WUXIAPPTEC WX115317-001 ; WUXIAPPTEC WX115317-010 |
pro_mdlNumber: | MFCD17017578 |
pro_acceptors: | 5 |
pro_donors: | 1 |
pro_smile: | CC(C)(C)OC(=O)N1CC2CNCC3CCOCC23C1 |
InChi: | InChI=1S/C15H26N2O3/c1-14(2,3)20-13(18)17-8-12-7-16-6-11-4-5-19-10-15(11,12)9-17/h11-12,16H,4-10H2,1-3H3 |
InChiKey: | InChIKey=CNZZEMHHLATVAV-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.