* If the product has intellectual property rights, a license granted is must or contact us.
|
|
Product_Name: | WUXIAPPTEC WX115320-001 |
EnglishSynonyms: | WUXIAPPTEC WX115320-001 ; WUXIAPPTEC WX115320-010 ; WUXIAPPTEC WX115320-005 |
pro_mdlNumber: | MFCD17017581 |
pro_acceptors: | 6 |
pro_donors: | 1 |
pro_smile: | CC(C)(C)OC(=O)N1CC2NC3=NC(Cl)=CC=C3COC2C1 |
InChi: | InChI=1S/C15H20ClN3O3/c1-15(2,3)22-14(20)19-6-10-11(7-19)21-8-9-4-5-12(16)18-13(9)17-10/h4-5,10-11H,6-8H2,1-3H3,(H,17,18) |
InChiKey: | InChIKey=WPRMKQQJMCCGJF-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.