* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product_Name: | WUXIAPPTEC WX115321-001 |
| EnglishSynonyms: | WUXIAPPTEC WX115321-001 ; WUXIAPPTEC WX115321-005 ; WUXIAPPTEC WX115321-010 |
| pro_mdlNumber: | MFCD17017582 |
| pro_acceptors: | 6 |
| pro_donors: | 1 |
| pro_smile: | CC(C)(C)OC(=O)N1CCC2NC3=NC(Cl)=CC=C3COC2C1 |
| InChi: | InChI=1S/C16H22ClN3O3/c1-16(2,3)23-15(21)20-7-6-11-12(8-20)22-9-10-4-5-13(17)19-14(10)18-11/h4-5,11-12H,6-9H2,1-3H3,(H,18,19) |
| InChiKey: | InChIKey=PWPDJMDQMDHNSH-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.