* If the product has intellectual property rights, a license granted is must or contact us.
|
|
Product_Name: | WUXIAPPTEC WX115322-001 |
EnglishSynonyms: | WUXIAPPTEC WX115322-010 ; WUXIAPPTEC WX115322-005 ; WUXIAPPTEC WX115322-001 |
pro_mdlNumber: | MFCD17017583 |
pro_acceptors: | 7 |
pro_donors: | 1 |
pro_smile: | CC(C)(C)OC(=O)N1CC2NC3=NC(Cl)=NC=C3COC2C1 |
InChi: | InChI=1S/C14H19ClN4O3/c1-14(2,3)22-13(20)19-5-9-10(6-19)21-7-8-4-16-12(15)18-11(8)17-9/h4,9-10H,5-7H2,1-3H3,(H,16,17,18) |
InChiKey: | InChIKey=IRJOOKOOBJGVGN-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.