* If the product has intellectual property rights, a license granted is must or contact us.
|
|
Product_Name: | WUXIAPPTEC WX115326-001 |
EnglishSynonyms: | WUXIAPPTEC WX115326-001 ; WUXIAPPTEC WX115326-010 ; WUXIAPPTEC WX115326-005 |
pro_mdlNumber: | MFCD17017587 |
pro_acceptors: | 4 |
pro_donors: | 2 |
pro_smile: | ClC1=CC=C2CNC3COCC3NC2=N1 |
InChi: | InChI=1S/C10H12ClN3O/c11-9-2-1-6-3-12-7-4-15-5-8(7)13-10(6)14-9/h1-2,7-8,12H,3-5H2,(H,13,14) |
InChiKey: | InChIKey=YCOKDWUDLQFAGD-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.