* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product_Name: | WUXIAPPTEC WX115328-001 |
| EnglishSynonyms: | WUXIAPPTEC WX115328-001 ; WUXIAPPTEC WX115328-005 ; WUXIAPPTEC WX115328-010 |
| pro_mdlNumber: | MFCD17017589 |
| pro_acceptors: | 7 |
| pro_donors: | 2 |
| pro_smile: | CC(C)(C)OC(=O)N1CC2NCC3=CN=C(Cl)N=C3NC2C1 |
| InChi: | InChI=1S/C14H20ClN5O2/c1-14(2,3)22-13(21)20-6-9-10(7-20)18-11-8(4-16-9)5-17-12(15)19-11/h5,9-10,16H,4,6-7H2,1-3H3,(H,17,18,19) |
| InChiKey: | InChIKey=QBKFPKZXHZVOKY-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.