* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product_Name: | WUXIAPPTEC WX110364-001 |
| EnglishSynonyms: | WUXIAPPTEC WX110364-005 ; WUXIAPPTEC WX110364-010 ; WUXIAPPTEC WX110364-001 |
| pro_mdlNumber: | MFCD17017599 |
| pro_acceptors: | 5 |
| pro_donors: | 1 |
| pro_smile: | CC(C)(C)OC(=O)N1C[C@@H](F)[C@@H]2NCCO[C@]2(C)C1 |
| InChi: | InChI=1S/C13H23FN2O3/c1-12(2,3)19-11(17)16-7-9(14)10-13(4,8-16)18-6-5-15-10/h9-10,15H,5-8H2,1-4H3/t9-,10+,13-/m1/s1 |
| InChiKey: | InChIKey=UDGPGKRNCKJHNA-GBIKHYSHSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.