* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product_Name: | WUXIAPPTEC WX110365-001 |
| EnglishSynonyms: | WUXIAPPTEC WX110365-005 ; WUXIAPPTEC WX110365-001 ; WUXIAPPTEC WX110365-010 |
| pro_mdlNumber: | MFCD17017600 |
| pro_acceptors: | 5 |
| pro_donors: | 1 |
| pro_smile: | CC(C)(C)OC(=O)N1CC[C@]2(C)NCCO[C@@H]2C1 |
| InChi: | InChI=1S/C13H24N2O3/c1-12(2,3)18-11(16)15-7-5-13(4)10(9-15)17-8-6-14-13/h10,14H,5-9H2,1-4H3/t10-,13+/m1/s1 |
| InChiKey: | InChIKey=BXCYOUMWUDQDIJ-MFKMUULPSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.