* If the product has intellectual property rights, a license granted is must or contact us.
|
|
Product_Name: | WUXIAPPTEC WX110366-001 |
EnglishSynonyms: | WUXIAPPTEC WX110366-010 ; WUXIAPPTEC WX110366-005 ; WUXIAPPTEC WX110366-001 |
pro_mdlNumber: | MFCD17017601 |
pro_acceptors: | 5 |
pro_donors: | 1 |
pro_smile: | CC(C)(C)OC(=O)N1C[C@@H](F)[C@]2(C)NCCO[C@@H]2C1 |
InChi: | InChI=1S/C13H23FN2O3/c1-12(2,3)19-11(17)16-7-9(14)13(4)10(8-16)18-6-5-15-13/h9-10,15H,5-8H2,1-4H3/t9-,10-,13+/m1/s1 |
InChiKey: | InChIKey=RSYPCHSQNNLKKW-BREBYQMCSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.