* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product_Name: | WUXIAPPTEC WX110369-001 |
| EnglishSynonyms: | WUXIAPPTEC WX110369-001 ; WUXIAPPTEC WX110369-010 ; WUXIAPPTEC WX110369-005 |
| pro_mdlNumber: | MFCD17017604 |
| pro_acceptors: | 6 |
| pro_donors: | 1 |
| pro_smile: | CC(C)(C)OC(=O)N1CC[C@@H]2OCCN(CCO)[C@@H]2C1 |
| InChi: | InChI=1S/C14H26N2O4/c1-14(2,3)20-13(18)16-5-4-12-11(10-16)15(6-8-17)7-9-19-12/h11-12,17H,4-10H2,1-3H3/t11-,12+/m1/s1 |
| InChiKey: | InChIKey=FNNVCTDWFJJCCQ-NEPJUHHUSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.