* If the product has intellectual property rights, a license granted is must or contact us.
|
|
Product_Name: | WUXIAPPTEC WX115359-001 |
EnglishSynonyms: | WUXIAPPTEC WX115359-005 ; WUXIAPPTEC WX115359-010 ; WUXIAPPTEC WX115359-001 |
pro_mdlNumber: | MFCD17017688 |
pro_acceptors: | 5 |
pro_donors: | 1 |
pro_smile: | CC(C)(C)OC(=O)N1CC[C@H]2C[C@@H]3C4=C(C[C@]123)C=NN4 |
InChi: | InChI=1S/C15H21N3O2/c1-14(2,3)20-13(19)18-5-4-10-6-11-12-9(8-16-17-12)7-15(10,11)18/h8,10-11H,4-7H2,1-3H3,(H,16,17)/t10-,11+,15-/m0/s1 |
InChiKey: | InChIKey=SJUIGOQUVWPLKS-RWSFTLGLSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.