* If the product has intellectual property rights, a license granted is must or contact us.
|
|
Product_Name: | WUXIAPPTEC WX115370-001 |
EnglishSynonyms: | WUXIAPPTEC WX115370-010 ; WUXIAPPTEC WX115370-005 ; WUXIAPPTEC WX115370-001 |
pro_mdlNumber: | MFCD17017699 |
pro_acceptors: | 7 |
pro_donors: | 2 |
pro_smile: | CC(C)(C)OC(=O)N1CC2CC3(CCNC3)S(=O)(=O)NC2C1 |
InChi: | InChI=1S/C14H25N3O4S/c1-13(2,3)21-12(18)17-7-10-6-14(4-5-15-9-14)22(19,20)16-11(10)8-17/h10-11,15-16H,4-9H2,1-3H3 |
InChiKey: | InChIKey=OCJPVGDKWVITIC-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.