* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product_Name: | WUXIAPPTEC WX125137-001 |
| EnglishSynonyms: | WUXIAPPTEC WX125137-010 ; WUXIAPPTEC WX125137-001 ; WUXIAPPTEC WX125137-005 |
| pro_mdlNumber: | MFCD17017711 |
| pro_acceptors: | 5 |
| pro_donors: | 1 |
| pro_smile: | CC(C)(C)OC(=O)N1C2C=CC11CCN3CCC(N)C2C13 |
| InChi: | InChI=1S/C16H25N3O2/c1-15(2,3)21-14(20)19-11-4-6-16(19)7-9-18-8-5-10(17)12(11)13(16)18/h4,6,10-13H,5,7-9,17H2,1-3H3 |
| InChiKey: | InChIKey=VIJYTQLGVGWCML-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.