* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product_Name: | WUXIAPPTEC WX125139-001 |
| EnglishSynonyms: | WUXIAPPTEC WX125139-005 ; WUXIAPPTEC WX125139-010 ; WUXIAPPTEC WX125139-001 |
| pro_mdlNumber: | MFCD17017713 |
| pro_acceptors: | 5 |
| pro_donors: | 1 |
| pro_smile: | CC(C)(C)OC(=O)N1C2C=CC11COC3CCC(N)C2C13 |
| InChi: | InChI=1S/C16H24N2O3/c1-15(2,3)21-14(19)18-10-6-7-16(18)8-20-11-5-4-9(17)12(10)13(11)16/h6-7,9-13H,4-5,8,17H2,1-3H3 |
| InChiKey: | InChIKey=WBBDOGYRVDEXLG-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.