* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product_Name: | HDH-PHARMA 23763 |
| EnglishSynonyms: | HDH-PHARMA 23763 ; HDH-PHARMA 23764 ; HDH-PHARMA 23765 |
| pro_mdlNumber: | MFCD11873900 |
| pro_acceptors: | 4 |
| pro_donors: | 0 |
| pro_smile: | CC(C)(C)OC(=O)N1CCCC1COCC1=CC=C(F)C(=C1)C(F)(F)F |
| InChi: | InChI=1S/C18H23F4NO3/c1-17(2,3)26-16(24)23-8-4-5-13(23)11-25-10-12-6-7-15(19)14(9-12)18(20,21)22/h6-7,9,13H,4-5,8,10-11H2,1-3H3 |
| InChiKey: | InChIKey=BPMCRVAZVQQYSP-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.