* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product_Name: | WUXIAPPTEC WX115095-001 |
| EnglishSynonyms: | WUXIAPPTEC WX115095-010 ; WUXIAPPTEC WX115095-001 ; WUXIAPPTEC WX115095-005 |
| pro_mdlNumber: | MFCD17016581 |
| pro_acceptors: | 8 |
| pro_donors: | 1 |
| pro_smile: | CC(C)(C)OC(=O)N1CC[C@@H]2OCC3=C(N=CN3C2CC1)C(O)=O |
| InChi: | InChI=1S/C16H23N3O5/c1-16(2,3)24-15(22)18-6-4-10-12(5-7-18)23-8-11-13(14(20)21)17-9-19(10)11/h9-10,12H,4-8H2,1-3H3,(H,20,21)/t10?,12-/m0/s1 |
| InChiKey: | InChIKey=RZDULKXSSPQGNI-KFJBMODSSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.