* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product_Name: | WUXIAPPTEC WX115125-001 |
| EnglishSynonyms: | WUXIAPPTEC WX115125-010 ; WUXIAPPTEC WX115125-005 ; WUXIAPPTEC WX115125-001 |
| pro_mdlNumber: | MFCD17016609 |
| pro_acceptors: | 5 |
| pro_donors: | 1 |
| pro_smile: | CC(C)(C)OC(=O)N1CC2CCC3=C(C=NN3)C2C1 |
| InChi: | InChI=1S/C14H21N3O2/c1-14(2,3)19-13(18)17-7-9-4-5-12-10(6-15-16-12)11(9)8-17/h6,9,11H,4-5,7-8H2,1-3H3,(H,15,16) |
| InChiKey: | InChIKey=LRJNPSWSQRQLNI-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.