* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product_Name: | WUXIAPPTEC WX120129-001 |
| EnglishSynonyms: | WUXIAPPTEC WX120129-001 ; WUXIAPPTEC WX120129-005 ; WUXIAPPTEC WX120129-010 |
| pro_mdlNumber: | MFCD17016766 |
| pro_acceptors: | 6 |
| pro_donors: | 1 |
| pro_smile: | CCOC(=O)[C@H]1[C@H](N)C2CCC1N2C(=O)OC(C)(C)C |
| InChi: | InChI=1S/C14H24N2O4/c1-5-19-12(17)10-8-6-7-9(11(10)15)16(8)13(18)20-14(2,3)4/h8-11H,5-7,15H2,1-4H3/t8?,9?,10-,11-/m1/s1 |
| InChiKey: | InChIKey=OBZFCRYVNCFRDL-JPPWEJMLSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.