* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product_Name: | WUXIAPPTEC WX120132-001 |
| EnglishSynonyms: | WUXIAPPTEC WX120132-005 ; WUXIAPPTEC WX120132-010 ; WUXIAPPTEC WX120132-001 |
| pro_mdlNumber: | MFCD17016769 |
| pro_acceptors: | 4 |
| pro_donors: | 2 |
| pro_smile: | N[C@@H]1C2CCC3[C@H]1NC(=O)N23 |
| InChi: | InChI=1S/C7H11N3O/c8-5-3-1-2-4-6(5)9-7(11)10(3)4/h3-6H,1-2,8H2,(H,9,11)/t3?,4?,5-,6-/m1/s1 |
| InChiKey: | InChIKey=XNMHSDKEJNINMM-SXEFJBAOSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.