* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product_Name: | WUXIAPPTEC WX120163-001 |
| EnglishSynonyms: | WUXIAPPTEC WX120163-005 ; WUXIAPPTEC WX120163-010 ; WUXIAPPTEC WX120163-001 |
| pro_mdlNumber: | MFCD17016798 |
| pro_acceptors: | 4 |
| pro_donors: | 1 |
| pro_smile: | CCOC(=O)[C@H]1C[N@@]2CC[C@H]1[C@H](N)C2 |
| InChi: | InChI=1S/C10H18N2O2/c1-2-14-10(13)8-5-12-4-3-7(8)9(11)6-12/h7-9H,2-6,11H2,1H3/t7-,8+,9-/m1/s1 |
| InChiKey: | InChIKey=KJHJXBBXQNAXDM-HRDYMLBCSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.