* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product_Name: | WUXIAPPTEC WX115245-001 |
| EnglishSynonyms: | WUXIAPPTEC WX115245-001 ; WUXIAPPTEC WX115245-005 ; WUXIAPPTEC WX115245-010 |
| pro_mdlNumber: | MFCD17017396 |
| pro_acceptors: | 6 |
| pro_donors: | 0 |
| pro_smile: | BrC1=CN2C[C@@H]3[C@@H](OCCN3C(=O)OCC3=CC=CC=C3)C2=N1 |
| InChi: | InChI=1S/C16H16BrN3O3/c17-13-9-19-8-12-14(15(19)18-13)22-7-6-20(12)16(21)23-10-11-4-2-1-3-5-11/h1-5,9,12,14H,6-8,10H2/t12-,14-/m1/s1 |
| InChiKey: | InChIKey=QGKMURKKOCQFTC-TZMCWYRMSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.