* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product_Name: | WUXIAPPTEC WX125068-001 |
| EnglishSynonyms: | WUXIAPPTEC WX125068-005 ; WUXIAPPTEC WX125068-010 ; WUXIAPPTEC WX125068-001 |
| pro_mdlNumber: | MFCD17016857 |
| pro_acceptors: | 8 |
| pro_donors: | 0 |
| pro_smile: | CSC1=NC2=C(C=N1)C1CN(CC(C2)N1C(=O)OCC1=CC=CC=C1)C(=O)OC(C)(C)C |
| InChi: | InChI=1S/C23H28N4O4S/c1-23(2,3)31-21(28)26-12-16-10-18-17(11-24-20(25-18)32-4)19(13-26)27(16)22(29)30-14-15-8-6-5-7-9-15/h5-9,11,16,19H,10,12-14H2,1-4H3 |
| InChiKey: | InChIKey=LAYGWDDMBXUYCI-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.